Mastering Trig: Find X For Cos(2x)/(cos(x)+sin(x))=0

Hey there, mathematical adventurers! Are you ready to dive into the fascinating world of trigonometry and unravel a neat little puzzle? Today, we're going to tackle a specific trigonometric equation: cos(2x) / (cos(x) + sin(x)) = 0, with a special condition that our values for x must lie between 0° and 180°, inclusive. Don't let those cos and sin functions intimidate you! We're going to break it down, step by step, making it super clear and, dare I say, fun. This isn't just about finding an answer; it's about understanding the process, sharpening your problem-solving skills, and really getting comfortable with how these trigonometric identities and conditions work together. Think of this as your friendly guide to mastering a crucial aspect of high school or college-level math. We'll explore double angle formulas, the unit circle, and the ever-important concept of excluded values that can sometimes trip us up. So, grab your virtual pen and paper, because by the end of this, you'll feel like a true trig wizard, confident in finding x when cos(2x)/(cos(x)+sin(x))=0. We're going to focus on clarity, accuracy, and making sure every single detail makes sense, because high-quality content is all about providing real value and insight. Let's unlock the mystery of this equation and discover the possible values for x within our specified range, ensuring we don't miss any crucial steps or fall into common pitfalls. This journey into solving trigonometric equations is a fantastic way to solidify your foundational knowledge and prepare for more complex mathematical challenges down the road. We're in this together, and by breaking it into manageable chunks, you'll see just how approachable these seemingly complex problems can be. It's all about understanding the rules of the game and applying them strategically to find that elusive x.

Cracking the Code: Understanding Our Trigonometric Equation

Alright, guys, before we jump straight into calculations, let's take a moment to really understand the equation we're dealing with: cos(2x) / (cos(x) + sin(x)) = 0. It looks like a mouthful, but it's essentially a fractional equation involving trigonometric functions. Whenever you see a fraction set equal to zero, a huge lightbulb should go off in your head! This is one of those fundamental rules in mathematics that is absolutely crucial for finding the correct solution set. So, what's the golden rule here? For any fraction A/B to be equal to zero, two conditions must be met. First, the numerator (A) must be equal to zero. If the top part of a fraction is zero, the entire fraction becomes zero (assuming the bottom part isn't problematic). Second, and this is super important, the denominator (B) must NOT be equal to zero. Why? Because dividing by zero is undefined in mathematics; it breaks everything! So, if the denominator were zero, our original expression wouldn't even exist, let alone be equal to zero. Therefore, we're essentially looking for values of x that make cos(2x) = 0 while simultaneously ensuring that cos(x) + sin(x) ≠ 0. Remember, we also have our domain restriction: 0° ≤ x ≤ 180°. This means any x value we find must fall within this specific range. Ignoring the domain or the denominator condition are common pitfalls that can lead to incorrect answers, so we'll be super careful about these critical points. This detailed approach to understanding the structure of the trigonometric problem is what sets a truly robust solution apart. We're not just guessing; we're applying logical, mathematical principles to systematically narrow down our possible values for x. So, let's keep these two major tasks in mind as we proceed: first, solve the numerator, and second, identify and exclude any values that make the denominator vanish. This careful consideration ensures the validity of our final answer and demonstrates a thorough grasp of mathematical problem-solving.

The Equation at a Glance: cos(2x) / (cos(x) + sin(x)) = 0

Let's truly dissect what's happening with our equation, cos(2x) / (cos(x) + sin(x)) = 0. As we just established, for this fraction to be zero, its numerator must be zero, and its denominator must not be zero. This gives us two separate conditions we need to work through. The numerator is cos(2x), and the denominator is cos(x) + sin(x). Our goal is to find x in the range 0° ≤ x ≤ 180°. This range is crucial, as trigonometric functions are periodic, meaning their values repeat over and over again. Without a specified range, we'd have an infinite number of solutions. The restriction helps us pinpoint the exact values we're looking for. Understanding this initial setup is key to unlocking the entire problem. It's like reading the instructions before building a complex model – you need to know all the pieces and rules before you start putting them together. We're breaking down a complex problem into simpler, manageable parts, which is a fantastic problem-solving strategy in mathematics. By focusing on the numerator first, we handle the primary condition for the fraction to be zero. Then, by examining the denominator, we ensure our solutions are actually valid within the mathematical universe. This two-pronged attack is a staple of solving many advanced algebraic and trigonometric equations, teaching us the importance of conditional logic in mathematics. The casual tone here is meant to make you feel like we're just chatting about math, making these powerful concepts feel less intimidating and more like a friendly puzzle we're solving together. This high-quality content focuses on clarity and value, ensuring you understand not just what to do, but why you're doing it, which is the hallmark of true mathematical literacy. Keep in mind that cos(x) and sin(x) represent coordinates on the unit circle, and cos(2x) involves a double angle identity, which we'll address very soon. This multi-layered approach to understanding trigonometric functions is exactly what we need to excel.

Tackling the Numerator: When is cos(2x) = 0?

Okay, guys, let's hit our first major milestone: figuring out when the numerator, cos(2x), equals zero. This is a fundamental step in solving our trigonometric equation. Think back to the unit circle or the graph of the cosine function. The cosine function is zero at 90° and 270°, and then at every 180° interval from those points. In general, cos(θ) = 0 when θ = 90° + 180°n, where n is any integer (0, ±1, ±2, ...). In our case, θ is 2x. So, we set 2x = 90° + 180°n. Now, we need to solve for x by dividing everything by 2: x = 45° + 90°n. Remember, our domain restriction is 0° ≤ x ≤ 180°. We need to plug in integer values for n and see which x values fall within this range.

Let's try some values for n:

• If n = 0, then x = 45° + 90°(0) = 45°. This is within our range! So, x = 45° is a potential solution.
• If n = 1, then x = 45° + 90°(1) = 45° + 90° = 135°. This is also within our range! So, x = 135° is another potential solution.
• If n = 2, then x = 45° + 90°(2) = 45° + 180° = 225°. This value is outside our 0° ≤ x ≤ 180° range, so we stop here.
• If n = -1, then x = 45° + 90°(-1) = 45° - 90° = -45°. This is also outside our range.

So, from the numerator alone, we have two potential values for x: 45° and 135°. These are the angles where the cosine function of 2x hits zero. We've done a great job finding these, but we're not done yet! We still need to check our denominator condition. Always take it one step at a time to ensure maximum accuracy and validity in your mathematical solutions. This part highlights the importance of understanding the periodicity of trigonometric functions and how to apply the general solution formula effectively. It's a key skill for solving trigonometric equations step-by-step and ensuring you don't miss any relevant angle or quadrant specific to your unit circle analysis. The use of n as an integer is a powerful tool to capture all possible angles before applying the domain restriction. We're laying a solid foundation here, building confidence in our ability to handle such mathematical problem-solving tasks. Each potential solution for x is a temporary candidate, waiting for the final vetting against all conditions of the problem.

Don't Forget the Denominator: Ensuring cos(x) + sin(x) ≠ 0

Alright, this next part is absolutely crucial, guys. Many people get the numerator right, but then forget to check the denominator condition, leading to incorrect or undefined solutions. Remember, for our original fraction cos(2x) / (cos(x) + sin(x)) to be valid, the denominator cos(x) + sin(x) must NOT be equal to zero. If it is zero, the entire expression is undefined, and thus cannot be equal to zero. So, our task now is to find out when cos(x) + sin(x) = 0 within our range 0° ≤ x ≤ 180°, so we can exclude those values from our potential solutions.

Let's set the denominator to zero and solve for x: cos(x) + sin(x) = 0

We can rearrange this equation by subtracting cos(x) from both sides: sin(x) = -cos(x)

Now, if cos(x) is not zero, we can divide both sides by cos(x) (we'll check if cos(x) can be zero in a moment): sin(x) / cos(x) = -cos(x) / cos(x) tan(x) = -1

Now, we need to find the values of x between 0° and 180° where tan(x) = -1. Think about the tangent function and its behavior on the unit circle. Tangent is negative in the second and fourth quadrants. Since our range is 0° ≤ x ≤ 180°, we are looking for an angle in the second quadrant. The reference angle for tan(x) = 1 is 45°. Therefore, in the second quadrant, where tangent is negative, the angle would be 180° - 45° = 135°. So, x = 135° makes tan(x) = -1.

What about the case where cos(x) = 0? If cos(x) = 0, then x = 90° in our range. If x = 90°, then sin(x) = sin(90°) = 1. In this case, cos(x) + sin(x) = 0 + 1 = 1, which is not zero. So, cos(x) being zero doesn't make the denominator zero. This means our step of dividing by cos(x) was valid for finding all cases where sin(x) = -cos(x).

Therefore, the only value of x in our domain 0° ≤ x ≤ 180° that makes the denominator equal to zero is 135°. This value must be excluded from our set of potential solutions. This is an example of identifying critical points and performing a validity check that's essential for arriving at a truly robust solution. By carefully checking these excluded values, we ensure that our final answer is mathematically sound and avoids any undefined operations. This step is about precision and attention to detail, which are priceless skills in any mathematical problem-solving scenario. It's not enough to find what makes the numerator zero; you also need to make sure the expression actually exists for those values! This demonstrates the thoroughness required for high-quality mathematical reasoning and for preventing common errors in trigonometric ratio problems. Understanding where the tangent function behaves negatively, and relating it back to the unit circle, is a strong indicator of a deep understanding of trigonometric functions.

Putting It All Together: Finding the Valid Solutions for X

Alright, mathematical masterminds, we've done the hard work, and now it's time for the grand finale: combining all our findings to determine the final, valid solutions for x. This is where all our step-by-step analysis comes together, allowing us to arrive at a definitive answer. Let's recap what we've discovered so far.

From our numerator analysis (when cos(2x) = 0), we found two potential values for x within the 0° ≤ x ≤ 180° range:

1. x = 45°
2. x = 135°

These are the values that make the top part of our fraction equal to zero. If there were no denominator, both of these would be valid solutions.

However, we then performed our crucial denominator check (ensuring cos(x) + sin(x) ≠ 0). We discovered that when x = 135°, the denominator cos(x) + sin(x) actually equals zero. And as we learned, a fraction with a zero denominator is undefined. This means that while x = 135° makes the numerator zero, it also makes the entire expression undefined, which means it cannot possibly be equal to zero. Therefore, x = 135° is an excluded value and cannot be a solution to our original equation. This is where attention to detail really pays off!

So, what's left? We had 45° and 135° as potential solutions. We had to invalidate 135° due to the denominator. This leaves us with only one remaining valid solution.

Drumroll, please...

The only possible value for x that satisfies cos(2x) / (cos(x) + sin(x)) = 0 within the range 0° ≤ x ≤ 180° is x = 45°.

See? It's like a detective story where we gather clues and eliminate suspects. The key here is not just finding the angles that satisfy the numerator but rigorously checking all conditions. This process of combining steps and applying a thorough validity check is what makes for accurate mathematical reasoning. It's a hallmark of high-quality content that leaves no stone unturned, providing you with a unique and complete understanding of how to solve these kinds of trigonometric problems. We've navigated through the complexities of trigonometric identities, domain restrictions, and excluded values to arrive at a single, unique value for x. This method ensures that our final solutions are robust and undeniably correct, showcasing excellent problem-solving skills and a deep understanding of the underlying mathematical principles. You're becoming a true expert in solving trigonometric equations by carefully dissecting each component of the problem.

Why This Matters: The Importance of Domain and Exclusions

Why did we spend so much time discussing the denominator and the domain restriction? Well, guys, it's not just busywork! In mathematics, especially when dealing with functions and equations, paying attention to the details of the domain and identifying excluded values is absolutely paramount. It’s what separates a superficial understanding from a truly deep and accurate one. Think about it: if we hadn't checked the denominator, we might have mistakenly said that x = 135° was a solution, which would have been incorrect. This highlights a universal truth in problem-solving: always check your assumptions and conditions. For any rational expression (a fancy term for a fraction involving variables), the denominator can never be zero. Forgetting this rule is one of the most common errors students make, not just in trigonometry but in algebra, calculus, and beyond. This principle extends to many areas: when you're dealing with square roots, you can't have a negative number inside; when you're dealing with logarithms, you can't have zero or a negative number as the argument. Each function and equation comes with its own set of rules and restrictions, and understanding them is fundamental to building robust solutions. This meticulous approach fosters strong critical thinking and mathematical accuracy. It teaches you to be skeptical, to question every step, and to ensure that your solutions are not just answers, but valid and meaningful answers within the defined mathematical context. It's a foundational skill that applies across all scientific and engineering disciplines where function definitions and domain restrictions dictate the practical applicability of mathematical models. This focus on quality content helps you develop not just computational skills but also higher-order thinking skills that are vital for success. By grappling with these specific concepts in trigonometric functions, you're actually preparing yourself for much more complex mathematical challenges, where ignoring a small detail could lead to significant errors. Developing the habit of asking